C21H34Br2O — CID 154349572
(3S,8S,9S,10R,13R,14S,17S)-5,6-dibromo-17-ethyl-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 154349572) has the molecular formula C21H34Br2O and a molecular weight of 462.31 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17S)-5,6-dibromo-17-ethyl-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17S)-5,6-dibromo-17-ethyl-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 154349572 |
| Molecular Formula | C21H34Br2O |
| Molecular Weight | 462.31 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17S)-5,6-dibromo-17-ethyl-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CC(Br)C4(Br)C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H34Br2O/c1-4-13-5-6-16-15-11-18(22)21(23)12-14(24)7-10-20(21,3)17(15)8-9-19(13,16)2/h13-18,24H,4-12H2,1-3H3/t13-,14-,15-,16-,17-,18?,19+,20+,21?/m0/s1 |
| InChIKey | SMLXBFXBPDHVNT-WORUYPCXSA-N |
| XLogP | 6.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.31 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|