C30H48BrNO2S — CID 135564117
2-(5-bromo-3-hydroxy-10,13-dimethyl-17-octyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-yl)-1,3-thiazol-4-one (PubChem CID 135564117) has the molecular formula C30H48BrNO2S and a molecular weight of 566.69 g/mol. Its IUPAC name is 2-(5-bromo-3-hydroxy-10,13-dimethyl-17-octyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-yl)-1,3-thiazol-4-one.
| Compound Name | 2-(5-bromo-3-hydroxy-10,13-dimethyl-17-octyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 135564117 |
| Molecular Formula | C30H48BrNO2S |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 2-(5-bromo-3-hydroxy-10,13-dimethyl-17-octyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-yl)-1,3-thiazol-4-one |
| SMILES | CCCCCCCCC1CCC2C3CC(C4=NC(=O)CS4)C4(Br)CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C30H48BrNO2S/c1-4-5-6-7-8-9-10-20-11-12-23-22-17-25(27-32-26(34)19-35-27)30(31)18-21(33)13-16-29(30,3)24(22)14-15-28(20,23)2/h20-25,33H,4-19H2,1-3H3 |
| InChIKey | SJHBUAPDHKUOHD-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|