C28H48O3 — CID 100974554
(3R,5R,8S,9S,10R,13R,14S,17S)-3-hydroxy-5-methoxy-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 100974554) has the molecular formula C28H48O3 and a molecular weight of 432.69 g/mol. Its IUPAC name is (3R,5R,8S,9S,10R,13R,14S,17S)-3-hydroxy-5-methoxy-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (3R,5R,8S,9S,10R,13R,14S,17S)-3-hydroxy-5-methoxy-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 100974554 |
| Molecular Formula | C28H48O3 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | (3R,5R,8S,9S,10R,13R,14S,17S)-3-hydroxy-5-methoxy-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | CCCCCCCC[C@H]1CC[C@H]2[C@@H]3CC(=O)[C@@]4(OC)C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H48O3/c1-5-6-7-8-9-10-11-20-12-13-23-22-18-25(30)28(31-4)19-21(29)14-17-27(28,3)24(22)15-16-26(20,23)2/h20-24,29H,5-19H2,1-4H3/t20-,21+,22-,23-,24-,26+,27+,28-/m0/s1 |
| InChIKey | OLRRHAASFXDJPV-CERQIBMSSA-N |
| XLogP | 6.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|