C31H48O4 — CID 100995221
(5R,6S,8S,9S,10R,13R,14S,17S)-5-hydroxy-10,13-dimethyl-3'-methylidene-17-octylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-6,5'-oxolane]-2',3-dione (PubChem CID 100995221) has the molecular formula C31H48O4 and a molecular weight of 484.72 g/mol. Its IUPAC name is (5R,6S,8S,9S,10R,13R,14S,17S)-5-hydroxy-10,13-dimethyl-3'-methylidene-17-octylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-6,5'-oxolane]-2',3-dione.
| Compound Name | (5R,6S,8S,9S,10R,13R,14S,17S)-5-hydroxy-10,13-dimethyl-3'-methylidene-17-octylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-6,5'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 100995221 |
| Molecular Formula | C31H48O4 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | (5R,6S,8S,9S,10R,13R,14S,17S)-5-hydroxy-10,13-dimethyl-3'-methylidene-17-octylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-6,5'-oxolane]-2',3-dione |
| SMILES | C=C1C[C@]2(C[C@H]3[C@@H]4CC[C@H](CCCCCCCC)[C@@]4(C)CC[C@@H]3[C@@]3(C)CCC(=O)C[C@]23O)OC1=O |
| InChI | InChI=1S/C31H48O4/c1-5-6-7-8-9-10-11-22-12-13-25-24-20-30(18-21(2)27(33)35-30)31(34)19-23(32)14-17-29(31,4)26(24)15-16-28(22,25)3/h22,24-26,34H,2,5-20H2,1,3-4H3/t22-,24-,25-,26-,28+,29+,30+,31+/m0/s1 |
| InChIKey | GRRWRSQLVUPPCR-KUYXGFPCSA-N |
| XLogP | 6.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|