C33H52 — CID 134866135
(8S,10S,13R,17S)-10,13-dimethyl-17-octyl-3-phenyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 134866135) has the molecular formula C33H52 and a molecular weight of 448.78 g/mol. Its IUPAC name is (8S,10S,13R,17S)-10,13-dimethyl-17-octyl-3-phenyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,10S,13R,17S)-10,13-dimethyl-17-octyl-3-phenyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 134866135 |
| Molecular Formula | C33H52 |
| Molecular Weight | 448.78 g/mol |
| Exact Mass | 448.41 |
| IUPAC Name | (8S,10S,13R,17S)-10,13-dimethyl-17-octyl-3-phenyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CCCCCCCC[C@H]1CCC2[C@@H]3CCC4CC(c5ccccc5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C33H52/c1-4-5-6-7-8-12-15-27-17-19-30-29-18-16-28-24-26(25-13-10-9-11-14-25)20-22-33(28,3)31(29)21-23-32(27,30)2/h9-11,13-14,26-31H,4-8,12,15-24H2,1-3H3/t26?,27-,28?,29-,30?,31?,32+,33-/m0/s1 |
| InChIKey | RXAGKYZFCXZYKC-RKZZJOESSA-N |
| XLogP | 10.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.78 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|