C28H49FS — CID 177471549
(2S,3S,5S,8S,9S,10S,13R,14S,17S)-2-fluoro-10,13-dimethyl-3-methylsulfanyl-17-octyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 177471549) has the molecular formula C28H49FS and a molecular weight of 436.77 g/mol. Its IUPAC name is (2S,3S,5S,8S,9S,10S,13R,14S,17S)-2-fluoro-10,13-dimethyl-3-methylsulfanyl-17-octyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (2S,3S,5S,8S,9S,10S,13R,14S,17S)-2-fluoro-10,13-dimethyl-3-methylsulfanyl-17-octyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 177471549 |
| Molecular Formula | C28H49FS |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 436.35 |
| IUPAC Name | (2S,3S,5S,8S,9S,10S,13R,14S,17S)-2-fluoro-10,13-dimethyl-3-methylsulfanyl-17-octyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CCCCCCCC[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@H](SC)[C@@H](F)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H49FS/c1-5-6-7-8-9-10-11-20-13-15-23-22-14-12-21-18-26(30-4)25(29)19-28(21,3)24(22)16-17-27(20,23)2/h20-26H,5-19H2,1-4H3/t20-,21-,22-,23-,24-,25-,26-,27+,28-/m0/s1 |
| InChIKey | XNAWCNNJTICYRY-XKVSFVCGSA-N |
| XLogP | 9.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|