C24H40O — CID 118666734
(1R,2S,11S,12S,16R)-2,16-dimethyl-15-pentyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane (PubChem CID 118666734) has the molecular formula C24H40O and a molecular weight of 344.58 g/mol. Its IUPAC name is (1R,2S,11S,12S,16R)-2,16-dimethyl-15-pentyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane.
| Compound Name | (1R,2S,11S,12S,16R)-2,16-dimethyl-15-pentyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane |
|---|---|
| PubChem CID | 118666734 |
| Molecular Formula | C24H40O |
| Molecular Weight | 344.58 g/mol |
| Exact Mass | 344.31 |
| IUPAC Name | (1R,2S,11S,12S,16R)-2,16-dimethyl-15-pentyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane |
| SMILES | CCCCCC1CC[C@H]2[C@@H]3CCC4CC5OC5C[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C24H40O/c1-4-5-6-7-16-9-11-19-18-10-8-17-14-21-22(25-21)15-24(17,3)20(18)12-13-23(16,19)2/h16-22H,4-15H2,1-3H3/t16?,17?,18-,19-,20+,21?,22?,23+,24-/m0/s1 |
| InChIKey | FHWFJRFPLDLIHN-KCCAFZSTSA-N |
| XLogP | 6.60 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|