C30H50ClNO — CID 135009231
(3R,10S,13R)-3'-chloro-10,13-dimethyl-17-octylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,4'-pyrrolidine]-2'-one (PubChem CID 135009231) has the molecular formula C30H50ClNO and a molecular weight of 476.19 g/mol. Its IUPAC name is (3R,10S,13R)-3'-chloro-10,13-dimethyl-17-octylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,4'-pyrrolidine]-2'-one.
| Compound Name | (3R,10S,13R)-3'-chloro-10,13-dimethyl-17-octylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,4'-pyrrolidine]-2'-one |
|---|---|
| PubChem CID | 135009231 |
| Molecular Formula | C30H50ClNO |
| Molecular Weight | 476.19 g/mol |
| Exact Mass | 475.36 |
| IUPAC Name | (3R,10S,13R)-3'-chloro-10,13-dimethyl-17-octylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,4'-pyrrolidine]-2'-one |
| SMILES | CCCCCCCCC1CCC2C3CCC4C[C@]5(CC[C@]4(C)C3CC[C@]12C)CNC(=O)C5Cl |
| InChI | InChI=1S/C30H50ClNO/c1-4-5-6-7-8-9-10-21-12-14-24-23-13-11-22-19-30(20-32-27(33)26(30)31)18-17-29(22,3)25(23)15-16-28(21,24)2/h21-26H,4-20H2,1-3H3,(H,32,33)/t21?,22?,23?,24?,25?,26?,28-,29+,30-/m1/s1 |
| InChIKey | SQLALOVFIYAEAQ-RJIBMPMPSA-N |
| XLogP | 8.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.19 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|