C30H52OS — CID 99568562
S-[(3S,5S,8S,9S,10S,13R,14S,17S)-10,13-dimethyl-17-octyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] propanethioate (PubChem CID 99568562) has the molecular formula C30H52OS and a molecular weight of 460.81 g/mol. Its IUPAC name is S-[(3S,5S,8S,9S,10S,13R,14S,17S)-10,13-dimethyl-17-octyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] propanethioate.
| Compound Name | S-[(3S,5S,8S,9S,10S,13R,14S,17S)-10,13-dimethyl-17-octyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] propanethioate |
|---|---|
| PubChem CID | 99568562 |
| Molecular Formula | C30H52OS |
| Molecular Weight | 460.81 g/mol |
| Exact Mass | 460.37 |
| IUPAC Name | S-[(3S,5S,8S,9S,10S,13R,14S,17S)-10,13-dimethyl-17-octyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] propanethioate |
| SMILES | CCCCCCCC[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](SC(=O)CC)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H52OS/c1-5-7-8-9-10-11-12-22-14-16-26-25-15-13-23-21-24(32-28(31)6-2)17-19-30(23,4)27(25)18-20-29(22,26)3/h22-27H,5-21H2,1-4H3/t22-,23-,24-,25-,26-,27-,29+,30-/m0/s1 |
| InChIKey | ZTCKLNAEULJWDY-JNEKNKNSSA-N |
| XLogP | 9.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.81 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|