C33H56Br2O2 — CID 124902764
[(3S,5S,6S,8S,9R,10R,13R,14R,17R)-5,6-dibromo-10,13-dimethyl-17-octyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] (3R)-3-methylpentanoate (PubChem CID 124902764) has the molecular formula C33H56Br2O2 and a molecular weight of 644.62 g/mol. Its IUPAC name is [(3S,5S,6S,8S,9R,10R,13R,14R,17R)-5,6-dibromo-10,13-dimethyl-17-octyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] (3R)-3-methylpentanoate.
| Compound Name | [(3S,5S,6S,8S,9R,10R,13R,14R,17R)-5,6-dibromo-10,13-dimethyl-17-octyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] (3R)-3-methylpentanoate |
|---|---|
| PubChem CID | 124902764 |
| Molecular Formula | C33H56Br2O2 |
| Molecular Weight | 644.62 g/mol |
| Exact Mass | 642.26 |
| IUPAC Name | [(3S,5S,6S,8S,9R,10R,13R,14R,17R)-5,6-dibromo-10,13-dimethyl-17-octyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] (3R)-3-methylpentanoate |
| SMILES | CCCCCCCC[C@@H]1CC[C@@H]2[C@@H]3C[C@H](Br)[C@]4(Br)C[C@@H](OC(=O)C[C@H](C)CC)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C33H56Br2O2/c1-6-8-9-10-11-12-13-24-14-15-27-26-21-29(34)33(35)22-25(37-30(36)20-23(3)7-2)16-19-32(33,5)28(26)17-18-31(24,27)4/h23-29H,6-22H2,1-5H3/t23-,24-,25+,26+,27-,28-,29+,31-,32-,33-/m1/s1 |
| InChIKey | VKBCMZKYIQGGGT-LSYWDOEXSA-N |
| XLogP | 10.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.62 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|