C31H51Br2ClO2 — CID 3733691
(5,6-dibromo-10,13-dimethyl-17-octyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl) 3-chlorobutanoate (PubChem CID 3733691) has the molecular formula C31H51Br2ClO2 and a molecular weight of 651.01 g/mol. Its IUPAC name is (5,6-dibromo-10,13-dimethyl-17-octyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl) 3-chlorobutanoate.
| Compound Name | (5,6-dibromo-10,13-dimethyl-17-octyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl) 3-chlorobutanoate |
|---|---|
| PubChem CID | 3733691 |
| Molecular Formula | C31H51Br2ClO2 |
| Molecular Weight | 651.01 g/mol |
| Exact Mass | 648.19 |
| IUPAC Name | (5,6-dibromo-10,13-dimethyl-17-octyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl) 3-chlorobutanoate |
| SMILES | CCCCCCCCC1CCC2C3CC(Br)C4(Br)CC(OC(=O)CC(C)Cl)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C31H51Br2ClO2/c1-5-6-7-8-9-10-11-22-12-13-25-24-19-27(32)31(33)20-23(36-28(35)18-21(2)34)14-17-30(31,4)26(24)15-16-29(22,25)3/h21-27H,5-20H2,1-4H3 |
| InChIKey | ZGAUSTXKOGYHHU-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.01 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|