C30H50O5 — CID 100974572
methyl (3S,3aR,5aS,5bR,8S,9aR,10R,10aS,10bS)-8-acetyloxy-9a-hydroxy-3a,5b-dimethyl-3-octyl-2,3,4,5,5a,6,7,8,9,10,10a,10b-dodecahydro-1H-cyclopenta[a]fluorene-10-carboxylate (PubChem CID 100974572) has the molecular formula C30H50O5 and a molecular weight of 490.73 g/mol. Its IUPAC name is methyl (3S,3aR,5aS,5bR,8S,9aR,10R,10aS,10bS)-8-acetyloxy-9a-hydroxy-3a,5b-dimethyl-3-octyl-2,3,4,5,5a,6,7,8,9,10,10a,10b-dodecahydro-1H-cyclopenta[a]fluorene-10-carboxylate.
| Compound Name | methyl (3S,3aR,5aS,5bR,8S,9aR,10R,10aS,10bS)-8-acetyloxy-9a-hydroxy-3a,5b-dimethyl-3-octyl-2,3,4,5,5a,6,7,8,9,10,10a,10b-dodecahydro-1H-cyclopenta[a]fluorene-10-carboxylate |
|---|---|
| PubChem CID | 100974572 |
| Molecular Formula | C30H50O5 |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 490.37 |
| IUPAC Name | methyl (3S,3aR,5aS,5bR,8S,9aR,10R,10aS,10bS)-8-acetyloxy-9a-hydroxy-3a,5b-dimethyl-3-octyl-2,3,4,5,5a,6,7,8,9,10,10a,10b-dodecahydro-1H-cyclopenta[a]fluorene-10-carboxylate |
| SMILES | CCCCCCCC[C@H]1CC[C@H]2[C@@H]3[C@@H](C(=O)OC)[C@]4(O)C[C@@H](OC(C)=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H50O5/c1-6-7-8-9-10-11-12-21-13-14-23-25-24(16-17-28(21,23)3)29(4)18-15-22(35-20(2)31)19-30(29,33)26(25)27(32)34-5/h21-26,33H,6-19H2,1-5H3/t21-,22-,23-,24-,25-,26-,28+,29+,30+/m0/s1 |
| InChIKey | HKFBPXSTWPXRCL-CDEPNZKNSA-N |
| XLogP | 6.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|