C29H46O3 — CID 90726621
[(10R,13R,17S)-10,13-dimethyl-17-octyl-7-oxo-1,2,3,6,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 90726621) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is [(10R,13R,17S)-10,13-dimethyl-17-octyl-7-oxo-1,2,3,6,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(10R,13R,17S)-10,13-dimethyl-17-octyl-7-oxo-1,2,3,6,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 90726621 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | [(10R,13R,17S)-10,13-dimethyl-17-octyl-7-oxo-1,2,3,6,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CCCCCCCC[C@H]1CCC2C3C(=O)CC4=CC(OC(C)=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C29H46O3/c1-5-6-7-8-9-10-11-21-12-13-24-27-25(15-17-28(21,24)3)29(4)16-14-23(32-20(2)30)18-22(29)19-26(27)31/h18,21,23-25,27H,5-17,19H2,1-4H3/t21-,23?,24?,25?,27?,28+,29-/m0/s1 |
| InChIKey | LAYLUBMINIHSQT-CXJVLFBRSA-N |
| XLogP | 7.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|