C34H58Br2O2 — CID 129448000
[(3S,5R,6S,8R,9R,10R,13S,14R,17S)-5,6-dibromo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] heptanoate (PubChem CID 129448000) has the molecular formula C34H58Br2O2 and a molecular weight of 658.64 g/mol. Its IUPAC name is [(3S,5R,6S,8R,9R,10R,13S,14R,17S)-5,6-dibromo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] heptanoate.
| Compound Name | [(3S,5R,6S,8R,9R,10R,13S,14R,17S)-5,6-dibromo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] heptanoate |
|---|---|
| PubChem CID | 129448000 |
| Molecular Formula | C34H58Br2O2 |
| Molecular Weight | 658.64 g/mol |
| Exact Mass | 656.28 |
| IUPAC Name | [(3S,5R,6S,8R,9R,10R,13S,14R,17S)-5,6-dibromo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] heptanoate |
| SMILES | CCCCCCC(=O)O[C@H]1CC[C@]2(C)[C@@H]3CC[C@]4(C)[C@H](CC[C@H]4[C@H](C)CCCC(C)C)[C@H]3C[C@H](Br)[C@@]2(Br)C1 |
| InChI | InChI=1S/C34H58Br2O2/c1-7-8-9-10-14-31(37)38-25-17-20-33(6)29-18-19-32(5)27(24(4)13-11-12-23(2)3)15-16-28(32)26(29)21-30(35)34(33,36)22-25/h23-30H,7-22H2,1-6H3/t24-,25+,26-,27+,28-,29-,30+,32+,33-,34+/m1/s1 |
| InChIKey | PDBJUWKMSORENK-UWSKSIGRSA-N |
| XLogP | 10.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.64 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|