C45H78O4 — CID 102320309
[(1S,2R,5S,7S,9R,11S,12S,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] 8-(3-octyloxiran-2-yl)octanoate (PubChem CID 102320309) has the molecular formula C45H78O4 and a molecular weight of 683.11 g/mol. Its IUPAC name is [(1S,2R,5S,7S,9R,11S,12S,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] 8-(3-octyloxiran-2-yl)octanoate.
| Compound Name | [(1S,2R,5S,7S,9R,11S,12S,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] 8-(3-octyloxiran-2-yl)octanoate |
|---|---|
| PubChem CID | 102320309 |
| Molecular Formula | C45H78O4 |
| Molecular Weight | 683.11 g/mol |
| Exact Mass | 682.59 |
| IUPAC Name | [(1S,2R,5S,7S,9R,11S,12S,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] 8-(3-octyloxiran-2-yl)octanoate |
| SMILES | CCCCCCCCC1OC1CCCCCCCC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]4[C@@H]3C[C@H]3O[C@]32C1 |
| InChI | InChI=1S/C45H78O4/c1-7-8-9-10-12-15-21-39-40(48-39)22-16-13-11-14-17-23-42(46)47-34-26-29-44(6)38-27-28-43(5)36(33(4)20-18-19-32(2)3)24-25-37(43)35(38)30-41-45(44,31-34)49-41/h32-41H,7-31H2,1-6H3/t33-,34+,35+,36-,37+,38+,39?,40?,41-,43-,44-,45-/m1/s1 |
| InChIKey | REHGBOGBMXABCW-YGFFNVLISA-N |
| XLogP | 12.40 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.11 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|