C34H50O3 — CID 125036968
[(1R,2R,5S,7R,9S,11R,12R,15S,16S)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] benzoate (PubChem CID 125036968) has the molecular formula C34H50O3 and a molecular weight of 506.77 g/mol. Its IUPAC name is [(1R,2R,5S,7R,9S,11R,12R,15S,16S)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] benzoate.
| Compound Name | [(1R,2R,5S,7R,9S,11R,12R,15S,16S)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] benzoate |
|---|---|
| PubChem CID | 125036968 |
| Molecular Formula | C34H50O3 |
| Molecular Weight | 506.77 g/mol |
| Exact Mass | 506.38 |
| IUPAC Name | [(1R,2R,5S,7R,9S,11R,12R,15S,16S)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] benzoate |
| SMILES | CC(C)CCC[C@@H](C)[C@@H]1CC[C@@H]2[C@H]3C[C@@H]4O[C@@]45C[C@@H](OC(=O)c4ccccc4)CC[C@]5(C)[C@@H]3CC[C@]21C |
| InChI | InChI=1S/C34H50O3/c1-22(2)10-9-11-23(3)27-14-15-28-26-20-30-34(37-30)21-25(36-31(35)24-12-7-6-8-13-24)16-19-33(34,5)29(26)17-18-32(27,28)4/h6-8,12-13,22-23,25-30H,9-11,14-21H2,1-5H3/t23-,25+,26-,27+,28-,29-,30+,32+,33-,34+/m1/s1 |
| InChIKey | ZSGQVYLOLWOUMN-OFHMBIOGSA-N |
| XLogP | 8.46 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.77 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|