C34H50O4 — CID 125035391
[(1R,2R,5S,7R,9S,10S,11R,12R,15S,16S)-10-hydroxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] benzoate (PubChem CID 125035391) has the molecular formula C34H50O4 and a molecular weight of 522.77 g/mol. Its IUPAC name is [(1R,2R,5S,7R,9S,10S,11R,12R,15S,16S)-10-hydroxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] benzoate.
| Compound Name | [(1R,2R,5S,7R,9S,10S,11R,12R,15S,16S)-10-hydroxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] benzoate |
|---|---|
| PubChem CID | 125035391 |
| Molecular Formula | C34H50O4 |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | [(1R,2R,5S,7R,9S,10S,11R,12R,15S,16S)-10-hydroxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] benzoate |
| SMILES | CC(C)CCC[C@@H](C)[C@@H]1CC[C@@H]2[C@H]3[C@H](O)[C@@H]4O[C@@]45C[C@@H](OC(=O)c4ccccc4)CC[C@]5(C)[C@@H]3CC[C@]21C |
| InChI | InChI=1S/C34H50O4/c1-21(2)10-9-11-22(3)25-14-15-26-28-27(17-18-32(25,26)4)33(5)19-16-24(20-34(33)30(38-34)29(28)35)37-31(36)23-12-7-6-8-13-23/h6-8,12-13,21-22,24-30,35H,9-11,14-20H2,1-5H3/t22-,24+,25+,26-,27-,28-,29+,30+,32+,33-,34+/m1/s1 |
| InChIKey | PDQICVUSZAAKRF-RVPKJGNMSA-N |
| XLogP | 7.44 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|