C34H48N2O7 — CID 125030372
[(1R,2R,5R,7R,9S,11S,12R,15S,16R)-2,16-dimethyl-15-[(2S)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] 3,5-dinitrobenzoate (PubChem CID 125030372) has the molecular formula C34H48N2O7 and a molecular weight of 596.77 g/mol. Its IUPAC name is [(1R,2R,5R,7R,9S,11S,12R,15S,16R)-2,16-dimethyl-15-[(2S)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] 3,5-dinitrobenzoate.
| Compound Name | [(1R,2R,5R,7R,9S,11S,12R,15S,16R)-2,16-dimethyl-15-[(2S)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 125030372 |
| Molecular Formula | C34H48N2O7 |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.35 |
| IUPAC Name | [(1R,2R,5R,7R,9S,11S,12R,15S,16R)-2,16-dimethyl-15-[(2S)-6-methylheptan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] 3,5-dinitrobenzoate |
| SMILES | CC(C)CCC[C@H](C)[C@@H]1CC[C@@H]2[C@@H]3C[C@@H]4O[C@@]45C[C@H](OC(=O)c4cc([N+](=O)[O-])cc([N+](=O)[O-])c4)CC[C@]5(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C34H48N2O7/c1-20(2)7-6-8-21(3)27-9-10-28-26-18-30-34(43-30)19-25(11-14-33(34,5)29(26)12-13-32(27,28)4)42-31(37)22-15-23(35(38)39)17-24(16-22)36(40)41/h15-17,20-21,25-30H,6-14,18-19H2,1-5H3/t21-,25+,26-,27-,28+,29+,30-,32+,33+,34-/m0/s1 |
| InChIKey | FGAOHUMBQGSZQZ-KTBFVKFOSA-N |
| XLogP | 8.28 |
| TPSA | 125.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|