C19H29FO3 — CID 66959756
(8S,9R,10R,13S,14S)-5-fluoro-3,17-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 66959756) has the molecular formula C19H29FO3 and a molecular weight of 324.44 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-5-fluoro-3,17-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (8S,9R,10R,13S,14S)-5-fluoro-3,17-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 66959756 |
| Molecular Formula | C19H29FO3 |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | (8S,9R,10R,13S,14S)-5-fluoro-3,17-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | C[C@]12CC[C@@H]3[C@@H](CC(=O)C4(F)CC(O)CC[C@]34C)[C@@H]1CCC2O |
| InChI | InChI=1S/C19H29FO3/c1-17-7-6-14-12(13(17)3-4-15(17)22)9-16(23)19(20)10-11(21)5-8-18(14,19)2/h11-15,21-22H,3-10H2,1-2H3/t11?,12-,13-,14+,15?,17-,18+,19?/m0/s1 |
| InChIKey | QFMBXFUCUUGUFI-RFRKDSHFSA-N |
| XLogP | 3.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |