C19H29F3O2 — CID 123804836
(3R,5R,8S,9S,10R,13S,14S)-5,6,6-trifluoro-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 123804836) has the molecular formula C19H29F3O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is (3R,5R,8S,9S,10R,13S,14S)-5,6,6-trifluoro-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (3R,5R,8S,9S,10R,13S,14S)-5,6,6-trifluoro-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 123804836 |
| Molecular Formula | C19H29F3O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (3R,5R,8S,9S,10R,13S,14S)-5,6,6-trifluoro-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC(F)(F)[C@@]4(F)C[C@H](O)CC[C@]34C)[C@@H]1CCC2O |
| InChI | InChI=1S/C19H29F3O2/c1-16-7-6-14-12(13(16)3-4-15(16)24)10-19(21,22)18(20)9-11(23)5-8-17(14,18)2/h11-15,23-24H,3-10H2,1-2H3/t11-,12+,13+,14+,15?,16+,17-,18-/m1/s1 |
| InChIKey | UDLYYHDLZGHQCX-QIKRYVJYSA-N |
| XLogP | 4.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |