C21H36O12S3 — CID 162982581
[(2S,3S,5S,6S,8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3-disulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] hydrogen sulfate (PubChem CID 162982581) has the molecular formula C21H36O12S3 and a molecular weight of 576.71 g/mol. Its IUPAC name is [(2S,3S,5S,6S,8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3-disulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] hydrogen sulfate.
| Compound Name | [(2S,3S,5S,6S,8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3-disulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 162982581 |
| Molecular Formula | C21H36O12S3 |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | [(2S,3S,5S,6S,8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3-disulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] hydrogen sulfate |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3C[C@H](OS(=O)(=O)O)[C@H]4C[C@H](OS(=O)(=O)O)[C@@H](OS(=O)(=O)O)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H36O12S3/c1-4-12-5-6-14-13-9-17(31-34(22,23)24)16-10-18(32-35(25,26)27)19(33-36(28,29)30)11-21(16,3)15(13)7-8-20(12,14)2/h12-19H,4-11H2,1-3H3,(H,22,23,24)(H,25,26,27)(H,28,29,30)/t12-,13-,14-,15-,16+,17-,18-,19-,20+,21+/m0/s1 |
| InChIKey | ZUQCPKNMGDKORR-MHFFDHQZSA-N |
| XLogP | 2.84 |
| TPSA | 190.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|