C26H44O12S3 — CID 102588452
[(8S,9S,10R,13R,14S,17R)-17-[(2R)-hept-6-en-2-yl]-10,13-dimethyl-2,3-disulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] hydrogen sulfate (PubChem CID 102588452) has the molecular formula C26H44O12S3 and a molecular weight of 644.83 g/mol. Its IUPAC name is [(8S,9S,10R,13R,14S,17R)-17-[(2R)-hept-6-en-2-yl]-10,13-dimethyl-2,3-disulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] hydrogen sulfate.
| Compound Name | [(8S,9S,10R,13R,14S,17R)-17-[(2R)-hept-6-en-2-yl]-10,13-dimethyl-2,3-disulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 102588452 |
| Molecular Formula | C26H44O12S3 |
| Molecular Weight | 644.83 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | [(8S,9S,10R,13R,14S,17R)-17-[(2R)-hept-6-en-2-yl]-10,13-dimethyl-2,3-disulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] hydrogen sulfate |
| SMILES | C=CCCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC(OS(=O)(=O)O)C4CC(OS(=O)(=O)O)C(OS(=O)(=O)O)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H44O12S3/c1-5-6-7-8-16(2)18-9-10-19-17-13-22(36-39(27,28)29)21-14-23(37-40(30,31)32)24(38-41(33,34)35)15-26(21,4)20(17)11-12-25(18,19)3/h5,16-24H,1,6-15H2,2-4H3,(H,27,28,29)(H,30,31,32)(H,33,34,35)/t16-,17+,18-,19+,20+,21?,22?,23?,24?,25-,26-/m1/s1 |
| InChIKey | GOZCNGYUUBBJHI-AJOKHVBMSA-N |
| XLogP | 4.42 |
| TPSA | 190.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.83 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|