C24H40O10S2 — CID 70676194
methyl (3R)-3-[(2S,3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3-disulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate (PubChem CID 70676194) has the molecular formula C24H40O10S2 and a molecular weight of 552.71 g/mol. Its IUPAC name is methyl (3R)-3-[(2S,3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3-disulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate.
| Compound Name | methyl (3R)-3-[(2S,3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3-disulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate |
|---|---|
| PubChem CID | 70676194 |
| Molecular Formula | C24H40O10S2 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | methyl (3R)-3-[(2S,3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3-disulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoate |
| SMILES | COC(=O)C[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@H](OS(=O)(=O)O)[C@@H](OS(=O)(=O)O)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H40O10S2/c1-14(11-22(25)32-4)17-7-8-18-16-6-5-15-12-20(33-35(26,27)28)21(34-36(29,30)31)13-24(15,3)19(16)9-10-23(17,18)2/h14-21H,5-13H2,1-4H3,(H,26,27,28)(H,29,30,31)/t14-,15+,16+,17-,18+,19+,20+,21+,23-,24+/m1/s1 |
| InChIKey | CGRWBFCTVHKLAM-KZSDVADXSA-N |
| XLogP | 3.83 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|