C27H48O8S2 — CID 10415490
[(2S,3S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2-sulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate (PubChem CID 10415490) has the molecular formula C27H48O8S2 and a molecular weight of 564.81 g/mol. Its IUPAC name is [(2S,3S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2-sulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate.
| Compound Name | [(2S,3S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2-sulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 10415490 |
| Molecular Formula | C27H48O8S2 |
| Molecular Weight | 564.81 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | [(2S,3S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2-sulfooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3CCC4C[C@H](OS(=O)(=O)O)[C@@H](OS(=O)(=O)O)C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H48O8S2/c1-17(2)7-6-8-18(3)21-11-12-22-20-10-9-19-15-24(34-36(28,29)30)25(35-37(31,32)33)16-27(19,5)23(20)13-14-26(21,22)4/h17-25H,6-16H2,1-5H3,(H,28,29,30)(H,31,32,33)/t18-,19?,20?,21-,22?,23?,24+,25+,26-,27+/m1/s1 |
| InChIKey | UGKOLQFCFBOVIF-XSLQGXFLSA-N |
| XLogP | 6.09 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.81 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|