C29H49IO3 — CID 101422091
[(2S,3R,5S,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl] 2-iodoacetate (PubChem CID 101422091) has the molecular formula C29H49IO3 and a molecular weight of 572.61 g/mol. Its IUPAC name is [(2S,3R,5S,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl] 2-iodoacetate.
| Compound Name | [(2S,3R,5S,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl] 2-iodoacetate |
|---|---|
| PubChem CID | 101422091 |
| Molecular Formula | C29H49IO3 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | [(2S,3R,5S,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl] 2-iodoacetate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O)[C@@H](OC(=O)CI)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H49IO3/c1-18(2)7-6-8-19(3)22-11-12-23-21-10-9-20-15-25(31)26(33-27(32)17-30)16-29(20,5)24(21)13-14-28(22,23)4/h18-26,31H,6-17H2,1-5H3/t19-,20+,21+,22-,23+,24+,25-,26+,28-,29+/m1/s1 |
| InChIKey | SQCDQDFETAGWCP-LVCCOZIMSA-N |
| XLogP | 7.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|