C29H46F3IO2 — CID 45044205
[(3S,5S)-3-iodo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl] 2,2,2-trifluoroacetate (PubChem CID 45044205) has the molecular formula C29H46F3IO2 and a molecular weight of 610.58 g/mol. Its IUPAC name is [(3S,5S)-3-iodo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(3S,5S)-3-iodo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 45044205 |
| Molecular Formula | C29H46F3IO2 |
| Molecular Weight | 610.58 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | [(3S,5S)-3-iodo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)CCC[C@@H](C)C1CCC2C3CC[C@H]4C[C@H](I)C(OC(=O)C(F)(F)F)CC4(C)C3CCC21C |
| InChI | InChI=1S/C29H46F3IO2/c1-17(2)7-6-8-18(3)21-11-12-22-20-10-9-19-15-24(33)25(35-26(34)29(30,31)32)16-28(19,5)23(20)13-14-27(21,22)4/h17-25H,6-16H2,1-5H3/t18-,19+,20?,21?,22?,23?,24+,25?,27?,28?/m1/s1 |
| InChIKey | UOMMDIWLOYTRIE-LACVELKKSA-N |
| XLogP | 9.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.58 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|