C19H26OS — CID 15929047
(8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-thione (PubChem CID 15929047) has the molecular formula C19H26OS and a molecular weight of 302.48 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-thione.
| Compound Name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-thione |
|---|---|
| PubChem CID | 15929047 |
| Molecular Formula | C19H26OS |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-thione |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=S)C=C[C@@]43C)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C19H26OS/c1-18-9-7-13(21)11-12(18)3-4-14-15-5-6-17(20)19(15,2)10-8-16(14)18/h7,9,11,14-17,20H,3-6,8,10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | TVWFXXVMTYYSCW-DYKIIFRCSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|