C24H36O2S — CID 15929051
(8R,9S,10R,13S,14S,17S)-17-(1-ethoxypropan-2-yloxy)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-thione (PubChem CID 15929051) has the molecular formula C24H36O2S and a molecular weight of 388.62 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17S)-17-(1-ethoxypropan-2-yloxy)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-thione.
| Compound Name | (8R,9S,10R,13S,14S,17S)-17-(1-ethoxypropan-2-yloxy)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-thione |
|---|---|
| PubChem CID | 15929051 |
| Molecular Formula | C24H36O2S |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-17-(1-ethoxypropan-2-yloxy)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-thione |
| SMILES | CCOCC(C)O[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=S)C=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H36O2S/c1-5-25-15-16(2)26-22-9-8-20-19-7-6-17-14-18(27)10-12-23(17,3)21(19)11-13-24(20,22)4/h10,12,14,16,19-22H,5-9,11,13,15H2,1-4H3/t16?,19-,20-,21-,22-,23-,24-/m0/s1 |
| InChIKey | HGIAJXZLDSAGMT-BLQAJSBSSA-N |
| XLogP | 5.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|