C21H26O — CID 54243267
(10R,13S)-17-ethenyl-10,13-dimethyl-4,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 54243267) has the molecular formula C21H26O and a molecular weight of 294.44 g/mol. Its IUPAC name is (10R,13S)-17-ethenyl-10,13-dimethyl-4,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13S)-17-ethenyl-10,13-dimethyl-4,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 54243267 |
| Molecular Formula | C21H26O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | (10R,13S)-17-ethenyl-10,13-dimethyl-4,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=CC1=CCC2C3CC=C4CC(=O)C=C[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C21H26O/c1-4-14-6-8-18-17-7-5-15-13-16(22)9-11-21(15,3)19(17)10-12-20(14,18)2/h4-6,9,11,17-19H,1,7-8,10,12-13H2,2-3H3/t17?,18?,19?,20-,21+/m1/s1 |
| InChIKey | QRMKTAQKKSZUQC-FVFODTBWSA-N |
| XLogP | 5.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|