C20H29FO — CID 70403096
(3S,8R,9S,10R,13S,14S,16S)-16-fluoro-3,10,13-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 70403096) has the molecular formula C20H29FO and a molecular weight of 304.45 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,16S)-16-fluoro-3,10,13-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,8R,9S,10R,13S,14S,16S)-16-fluoro-3,10,13-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 70403096 |
| Molecular Formula | C20H29FO |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,16S)-16-fluoro-3,10,13-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)[C@@H](F)C[C@@H]32)C1 |
| InChI | InChI=1S/C20H29FO/c1-12-6-8-19(2)13(10-12)4-5-14-15(19)7-9-20(3)16(14)11-17(21)18(20)22/h4,12,14-17H,5-11H2,1-3H3/t12-,14+,15-,16-,17-,19-,20-/m0/s1 |
| InChIKey | KHXWTWOXKFWGNF-VXXPJMIASA-N |
| XLogP | 5.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|