C27H40O4 — CID 99576342
[(1R,2S,4R,6S,10S,13S,14R,17R)-6-ethoxy-8,10,14-trimethyl-7-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-8,19-dien-17-yl] acetate (PubChem CID 99576342) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is [(1R,2S,4R,6S,10S,13S,14R,17R)-6-ethoxy-8,10,14-trimethyl-7-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-8,19-dien-17-yl] acetate.
| Compound Name | [(1R,2S,4R,6S,10S,13S,14R,17R)-6-ethoxy-8,10,14-trimethyl-7-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-8,19-dien-17-yl] acetate |
|---|---|
| PubChem CID | 99576342 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | [(1R,2S,4R,6S,10S,13S,14R,17R)-6-ethoxy-8,10,14-trimethyl-7-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-8,19-dien-17-yl] acetate |
| SMILES | CCO[C@@H]1C[C@H]2C[C@H]3[C@@H]4CC=C5C[C@H](OC(C)=O)CC[C@]5(C)[C@H]4CC[C@]3(C)C2=C(C)O1 |
| InChI | InChI=1S/C27H40O4/c1-6-29-24-14-18-13-23-21-8-7-19-15-20(31-17(3)28)9-11-26(19,4)22(21)10-12-27(23,5)25(18)16(2)30-24/h7,18,20-24H,6,8-15H2,1-5H3/t18-,20-,21-,22+,23+,24+,26+,27+/m1/s1 |
| InChIKey | FEDFCOPSAFXWTA-GZJUWTJPSA-N |
| XLogP | 6.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|