C28H38O4S — CID 11648475
ethyl (1R,2S,4S,10S,13S,14R,17S)-17-acetyloxy-8,10,14-trimethyl-7-thiapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-5,8,19-triene-5-carboxylate (PubChem CID 11648475) has the molecular formula C28H38O4S and a molecular weight of 470.68 g/mol. Its IUPAC name is ethyl (1R,2S,4S,10S,13S,14R,17S)-17-acetyloxy-8,10,14-trimethyl-7-thiapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-5,8,19-triene-5-carboxylate.
| Compound Name | ethyl (1R,2S,4S,10S,13S,14R,17S)-17-acetyloxy-8,10,14-trimethyl-7-thiapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-5,8,19-triene-5-carboxylate |
|---|---|
| PubChem CID | 11648475 |
| Molecular Formula | C28H38O4S |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | ethyl (1R,2S,4S,10S,13S,14R,17S)-17-acetyloxy-8,10,14-trimethyl-7-thiapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-5,8,19-triene-5-carboxylate |
| SMILES | CCOC(=O)C1=CSC(C)=C2[C@H]1C[C@H]1[C@@H]3CC=C4C[C@@H](OC(C)=O)CC[C@]4(C)[C@H]3CC[C@]21C |
| InChI | InChI=1S/C28H38O4S/c1-6-31-26(30)22-15-33-16(2)25-21(22)14-24-20-8-7-18-13-19(32-17(3)29)9-11-27(18,4)23(20)10-12-28(24,25)5/h7,15,19-21,23-24H,6,8-14H2,1-5H3/t19-,20+,21-,23-,24-,27-,28-/m0/s1 |
| InChIKey | IQMXLKKAKNVQNT-YTHFKDKOSA-N |
| XLogP | 6.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|