C26H35NO5 — CID 99569410
ethyl (2'R,3R,8R,9S,10R,13S,14S,17R)-3-acetyloxy-2'-cyano-10,13-dimethylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,3'-oxirane]-2'-carboxylate (PubChem CID 99569410) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is ethyl (2'R,3R,8R,9S,10R,13S,14S,17R)-3-acetyloxy-2'-cyano-10,13-dimethylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,3'-oxirane]-2'-carboxylate.
| Compound Name | ethyl (2'R,3R,8R,9S,10R,13S,14S,17R)-3-acetyloxy-2'-cyano-10,13-dimethylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,3'-oxirane]-2'-carboxylate |
|---|---|
| PubChem CID | 99569410 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | ethyl (2'R,3R,8R,9S,10R,13S,14S,17R)-3-acetyloxy-2'-cyano-10,13-dimethylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,3'-oxirane]-2'-carboxylate |
| SMILES | CCOC(=O)[C@]1(C#N)O[C@@]12CC[C@H]1[C@@H]3CC=C4C[C@H](OC(C)=O)CC[C@]4(C)[C@H]3CC[C@@]12C |
| InChI | InChI=1S/C26H35NO5/c1-5-30-22(29)25(15-27)26(32-25)13-10-21-19-7-6-17-14-18(31-16(2)28)8-11-23(17,3)20(19)9-12-24(21,26)4/h6,18-21H,5,7-14H2,1-4H3/t18-,19-,20+,21+,23+,24+,25+,26-/m1/s1 |
| InChIKey | PEDDBGCKUJLWLL-TYYICFJDSA-N |
| XLogP | 4.48 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|