C31H40O7 — CID 4614279
dimethyl 7-acetyl-2-acetyloxy-4a,6a-dimethyl-2,3,4,4b,5,6,8,10a,11,11a,11b,12-dodecahydro-1H-indeno[2,1-a]phenanthrene-9,10-dicarboxylate (PubChem CID 4614279) has the molecular formula C31H40O7 and a molecular weight of 524.65 g/mol. Its IUPAC name is dimethyl 7-acetyl-2-acetyloxy-4a,6a-dimethyl-2,3,4,4b,5,6,8,10a,11,11a,11b,12-dodecahydro-1H-indeno[2,1-a]phenanthrene-9,10-dicarboxylate.
| Compound Name | dimethyl 7-acetyl-2-acetyloxy-4a,6a-dimethyl-2,3,4,4b,5,6,8,10a,11,11a,11b,12-dodecahydro-1H-indeno[2,1-a]phenanthrene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 4614279 |
| Molecular Formula | C31H40O7 |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | dimethyl 7-acetyl-2-acetyloxy-4a,6a-dimethyl-2,3,4,4b,5,6,8,10a,11,11a,11b,12-dodecahydro-1H-indeno[2,1-a]phenanthrene-9,10-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2CC3C4CC=C5CC(OC(C)=O)CCC5(C)C4CCC3(C)C2=C(C(C)=O)C1 |
| InChI | InChI=1S/C31H40O7/c1-16(32)21-14-23(28(34)36-5)26(29(35)37-6)22-15-25-20-8-7-18-13-19(38-17(2)33)9-11-30(18,3)24(20)10-12-31(25,4)27(21)22/h7,19-20,22,24-25H,8-15H2,1-6H3 |
| InChIKey | VJQPERZKHQJDQQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|