C26H34O4S — CID 134838941
ethyl (2S,9S,13R,16S)-16-acetyloxy-9,13-dimethyl-7-thiapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),5,18-triene-6-carboxylate (PubChem CID 134838941) has the molecular formula C26H34O4S and a molecular weight of 442.62 g/mol. Its IUPAC name is ethyl (2S,9S,13R,16S)-16-acetyloxy-9,13-dimethyl-7-thiapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),5,18-triene-6-carboxylate.
| Compound Name | ethyl (2S,9S,13R,16S)-16-acetyloxy-9,13-dimethyl-7-thiapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),5,18-triene-6-carboxylate |
|---|---|
| PubChem CID | 134838941 |
| Molecular Formula | C26H34O4S |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | ethyl (2S,9S,13R,16S)-16-acetyloxy-9,13-dimethyl-7-thiapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),5,18-triene-6-carboxylate |
| SMILES | CCOC(=O)c1cc2c(s1)[C@@]1(C)CCC3C(CC=C4C[C@@H](OC(C)=O)CC[C@@]43C)[C@@H]1C2 |
| InChI | InChI=1S/C26H34O4S/c1-5-29-24(28)22-13-16-12-21-19-7-6-17-14-18(30-15(2)27)8-10-25(17,3)20(19)9-11-26(21,4)23(16)31-22/h6,13,18-21H,5,7-12,14H2,1-4H3/t18-,19?,20?,21-,25-,26-/m0/s1 |
| InChIKey | BMSQQMTYQPGYLD-POPMSFQXSA-N |
| XLogP | 5.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|