C32H44O7 — CID 162896962
1-(12-acetyloxy-3,14,17-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl 3-phenylprop-2-enoate (PubChem CID 162896962) has the molecular formula C32H44O7 and a molecular weight of 540.70 g/mol. Its IUPAC name is 1-(12-acetyloxy-3,14,17-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl 3-phenylprop-2-enoate.
| Compound Name | 1-(12-acetyloxy-3,14,17-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162896962 |
| Molecular Formula | C32H44O7 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | 1-(12-acetyloxy-3,14,17-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl 3-phenylprop-2-enoate |
| SMILES | CC(=O)OC1CC2C(CCC3CC(O)CCC32C)C2(O)CCC(O)(C(C)OC(=O)C=Cc3ccccc3)C12C |
| InChI | InChI=1S/C32H44O7/c1-20(38-28(35)13-10-22-8-6-5-7-9-22)31(36)16-17-32(37)25-12-11-23-18-24(34)14-15-29(23,3)26(25)19-27(30(31,32)4)39-21(2)33/h5-10,13,20,23-27,34,36-37H,11-12,14-19H2,1-4H3 |
| InChIKey | YJLCUOVXDGQBIT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|