C30H40O6 — CID 162965137
[(3S,5S,8S,9R,10S,12R,13S,14R,17R)-17-acetyl-3,8,14-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-yl] 3-phenylprop-2-enoate (PubChem CID 162965137) has the molecular formula C30H40O6 and a molecular weight of 496.64 g/mol. Its IUPAC name is [(3S,5S,8S,9R,10S,12R,13S,14R,17R)-17-acetyl-3,8,14-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-yl] 3-phenylprop-2-enoate.
| Compound Name | [(3S,5S,8S,9R,10S,12R,13S,14R,17R)-17-acetyl-3,8,14-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162965137 |
| Molecular Formula | C30H40O6 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | [(3S,5S,8S,9R,10S,12R,13S,14R,17R)-17-acetyl-3,8,14-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-yl] 3-phenylprop-2-enoate |
| SMILES | CC(=O)[C@@H]1CC[C@@]2(O)[C@]1(C)[C@H](OC(=O)C=Cc1ccccc1)C[C@@H]1[C@@]3(C)CC[C@H](O)C[C@@H]3CC[C@]12O |
| InChI | InChI=1S/C30H40O6/c1-19(31)23-13-16-30(35)28(23,3)25(36-26(33)10-9-20-7-5-4-6-8-20)18-24-27(2)14-12-22(32)17-21(27)11-15-29(24,30)34/h4-10,21-25,32,34-35H,11-18H2,1-3H3/t21-,22-,23-,24+,25+,27-,28-,29-,30+/m0/s1 |
| InChIKey | UJEMSGXFGQSJQU-ZXSMFVMGSA-N |
| XLogP | 4.06 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|