C32H42O8 — CID 10007849
[(3S,8S,9R,10R,13R,14R,17S)-17-(1-acetyloxyethyl)-3,8,14,17-tetrahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] (E)-3-phenylprop-2-enoate (PubChem CID 10007849) has the molecular formula C32H42O8 and a molecular weight of 554.68 g/mol. Its IUPAC name is [(3S,8S,9R,10R,13R,14R,17S)-17-(1-acetyloxyethyl)-3,8,14,17-tetrahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(3S,8S,9R,10R,13R,14R,17S)-17-(1-acetyloxyethyl)-3,8,14,17-tetrahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 10007849 |
| Molecular Formula | C32H42O8 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | [(3S,8S,9R,10R,13R,14R,17S)-17-(1-acetyloxyethyl)-3,8,14,17-tetrahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] (E)-3-phenylprop-2-enoate |
| SMILES | CC(=O)OC(C)[C@]1(O)CC[C@@]2(O)[C@]1(C)C(OC(=O)/C=C/c1ccccc1)C[C@@H]1[C@@]3(C)CC[C@H](O)CC3=CC[C@]12O |
| InChI | InChI=1S/C32H42O8/c1-20(39-21(2)33)30(36)16-17-32(38)29(30,4)26(40-27(35)11-10-22-8-6-5-7-9-22)19-25-28(3)14-13-24(34)18-23(28)12-15-31(25,32)37/h5-12,20,24-26,34,36-38H,13-19H2,1-4H3/b11-10+/t20?,24-,25+,26?,28-,29+,30+,31-,32+/m0/s1 |
| InChIKey | YHRMXSUWBSIQGK-QONPZCRMSA-N |
| XLogP | 3.46 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|