C36H45NO7 — CID 163093606
1-[3,14,17-trihydroxy-10,13-dimethyl-12-(3-phenylprop-2-enoyloxy)-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl pyridine-3-carboxylate (PubChem CID 163093606) has the molecular formula C36H45NO7 and a molecular weight of 603.76 g/mol. Its IUPAC name is 1-[3,14,17-trihydroxy-10,13-dimethyl-12-(3-phenylprop-2-enoyloxy)-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl pyridine-3-carboxylate.
| Compound Name | 1-[3,14,17-trihydroxy-10,13-dimethyl-12-(3-phenylprop-2-enoyloxy)-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 163093606 |
| Molecular Formula | C36H45NO7 |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 603.32 |
| IUPAC Name | 1-[3,14,17-trihydroxy-10,13-dimethyl-12-(3-phenylprop-2-enoyloxy)-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl pyridine-3-carboxylate |
| SMILES | CC(OC(=O)c1cccnc1)C1(O)CCC2(O)C3CCC4CC(O)CCC4(C)C3CC(OC(=O)C=Cc3ccccc3)C12C |
| InChI | InChI=1S/C36H45NO7/c1-23(43-32(40)25-10-7-19-37-22-25)35(41)17-18-36(42)28-13-12-26-20-27(38)15-16-33(26,2)29(28)21-30(34(35,36)3)44-31(39)14-11-24-8-5-4-6-9-24/h4-11,14,19,22-23,26-30,38,41-42H,12-13,15-18,20-21H2,1-3H3 |
| InChIKey | XKKFXYDHGCVUET-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|