C35H42O9 — CID 162944880
[(3R,7R,8S,9S,10R,12S,13R,14R,17S)-17-[(1S)-1-benzoyloxyethyl]-3,7,8,14,17-pentahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] benzoate (PubChem CID 162944880) has the molecular formula C35H42O9 and a molecular weight of 606.71 g/mol. Its IUPAC name is [(3R,7R,8S,9S,10R,12S,13R,14R,17S)-17-[(1S)-1-benzoyloxyethyl]-3,7,8,14,17-pentahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] benzoate.
| Compound Name | [(3R,7R,8S,9S,10R,12S,13R,14R,17S)-17-[(1S)-1-benzoyloxyethyl]-3,7,8,14,17-pentahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] benzoate |
|---|---|
| PubChem CID | 162944880 |
| Molecular Formula | C35H42O9 |
| Molecular Weight | 606.71 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | [(3R,7R,8S,9S,10R,12S,13R,14R,17S)-17-[(1S)-1-benzoyloxyethyl]-3,7,8,14,17-pentahydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1)[C@]1(O)CC[C@]2(O)[C@@]3(O)[C@H](O)C=C4C[C@H](O)CC[C@]4(C)[C@@H]3C[C@H](OC(=O)c3ccccc3)[C@@]21C |
| InChI | InChI=1S/C35H42O9/c1-21(43-29(38)22-10-6-4-7-11-22)33(40)16-17-34(41)32(33,3)28(44-30(39)23-12-8-5-9-13-23)20-26-31(2)15-14-25(36)18-24(31)19-27(37)35(26,34)42/h4-13,19,21,25-28,36-37,40-42H,14-18,20H2,1-3H3/t21-,25+,26-,27+,28-,31-,32+,33+,34+,35-/m0/s1 |
| InChIKey | IUXDXOFLHJPUBQ-IWBAVFQLSA-N |
| XLogP | 3.32 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.71 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|