C21H34O3 — CID 22844268
[(1S)-1-[(2S,4aR,4bS,8aS,10R,10aR)-1,2,10-trimethyl-7-oxo-1,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthren-2-yl]ethyl] acetate (PubChem CID 22844268) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is [(1S)-1-[(2S,4aR,4bS,8aS,10R,10aR)-1,2,10-trimethyl-7-oxo-1,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthren-2-yl]ethyl] acetate.
| Compound Name | [(1S)-1-[(2S,4aR,4bS,8aS,10R,10aR)-1,2,10-trimethyl-7-oxo-1,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthren-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 22844268 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | [(1S)-1-[(2S,4aR,4bS,8aS,10R,10aR)-1,2,10-trimethyl-7-oxo-1,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthren-2-yl]ethyl] acetate |
| SMILES | CC(=O)O[C@@H](C)[C@@]1(C)CC[C@@H]2[C@H]3CCC(=O)C[C@@H]3C[C@@H](C)[C@H]2C1C |
| InChI | InChI=1S/C21H34O3/c1-12-10-16-11-17(23)6-7-18(16)19-8-9-21(5,13(2)20(12)19)14(3)24-15(4)22/h12-14,16,18-20H,6-11H2,1-5H3/t12-,13?,14+,16+,18+,19-,20+,21+/m1/s1 |
| InChIKey | BJCRZJXMCPIYHP-MHBWOQNLSA-N |
| XLogP | 4.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |