C32H60O3Si2 — CID 10918647
(3S,7S,8R,9S,10R,13S,14S,17S)-3,17-bis[[tert-butyl(dimethyl)silyl]oxy]-7,10,13-trimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-ol (PubChem CID 10918647) has the molecular formula C32H60O3Si2 and a molecular weight of 549.00 g/mol. Its IUPAC name is (3S,7S,8R,9S,10R,13S,14S,17S)-3,17-bis[[tert-butyl(dimethyl)silyl]oxy]-7,10,13-trimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-ol.
| Compound Name | (3S,7S,8R,9S,10R,13S,14S,17S)-3,17-bis[[tert-butyl(dimethyl)silyl]oxy]-7,10,13-trimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-ol |
|---|---|
| PubChem CID | 10918647 |
| Molecular Formula | C32H60O3Si2 |
| Molecular Weight | 549.00 g/mol |
| Exact Mass | 548.41 |
| IUPAC Name | (3S,7S,8R,9S,10R,13S,14S,17S)-3,17-bis[[tert-butyl(dimethyl)silyl]oxy]-7,10,13-trimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@]2(C)C(=C[C@@](C)(O)[C@H]3[C@@H]4CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C32H60O3Si2/c1-28(2,3)36(10,11)34-23-16-18-30(7)22(20-23)21-32(9,33)27-24-14-15-26(31(24,8)19-17-25(27)30)35-37(12,13)29(4,5)6/h21,23-27,33H,14-20H2,1-13H3/t23-,24-,25-,26-,27-,30-,31-,32+/m0/s1 |
| InChIKey | VZPNVEAPUWJFPN-OPVGGYBHSA-N |
| XLogP | 9.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.00 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|