C28H50O3Si — CID 22875683
(8S,9S,10R,13S,14S,17S)-17-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-7,10,13-trimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,7-diol (PubChem CID 22875683) has the molecular formula C28H50O3Si and a molecular weight of 462.79 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-17-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-7,10,13-trimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,7-diol.
| Compound Name | (8S,9S,10R,13S,14S,17S)-17-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-7,10,13-trimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,7-diol |
|---|---|
| PubChem CID | 22875683 |
| Molecular Formula | C28H50O3Si |
| Molecular Weight | 462.79 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-17-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-7,10,13-trimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,7-diol |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@]12C)[C@@]1(C)CCC(O)CC1=CC3(C)O |
| InChI | InChI=1S/C28H50O3Si/c1-18(31-32(8,9)25(2,3)4)21-10-11-22-24-23(13-15-27(21,22)6)26(5)14-12-20(29)16-19(26)17-28(24,7)30/h17-18,20-24,29-30H,10-16H2,1-9H3/t18?,20?,21-,22+,23+,24+,26+,27-,28?/m1/s1 |
| InChIKey | CRGVUIANJVRFRA-TTZCOVTQSA-N |
| XLogP | 6.70 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.79 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|