C27H46O — CID 162881352
17-(4,4-dimethylhexan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 162881352) has the molecular formula C27H46O and a molecular weight of 386.66 g/mol. Its IUPAC name is 17-(4,4-dimethylhexan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 17-(4,4-dimethylhexan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 162881352 |
| Molecular Formula | C27H46O |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 386.35 |
| IUPAC Name | 17-(4,4-dimethylhexan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCC(C)(C)CC(C)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C27H46O/c1-7-25(3,4)17-18(2)22-10-11-23-21-9-8-19-16-20(28)12-14-26(19,5)24(21)13-15-27(22,23)6/h8,18,20-24,28H,7,9-17H2,1-6H3 |
| InChIKey | AEJXWOUODGGGMX-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|