C28H46O5Si — CID 10206689
[(3S,10R,13S,17S)-17-[dimethyl(propan-2-yl)silyl]oxy-10,13-dimethylspiro[1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-7,2'-1,3-dioxolane]-3-yl] acetate (PubChem CID 10206689) has the molecular formula C28H46O5Si and a molecular weight of 490.76 g/mol. Its IUPAC name is [(3S,10R,13S,17S)-17-[dimethyl(propan-2-yl)silyl]oxy-10,13-dimethylspiro[1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-7,2'-1,3-dioxolane]-3-yl] acetate.
| Compound Name | [(3S,10R,13S,17S)-17-[dimethyl(propan-2-yl)silyl]oxy-10,13-dimethylspiro[1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-7,2'-1,3-dioxolane]-3-yl] acetate |
|---|---|
| PubChem CID | 10206689 |
| Molecular Formula | C28H46O5Si |
| Molecular Weight | 490.76 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | [(3S,10R,13S,17S)-17-[dimethyl(propan-2-yl)silyl]oxy-10,13-dimethylspiro[1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-7,2'-1,3-dioxolane]-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC3(OCCO3)C3C2CC[C@@]2(C)C3CC[C@@H]2O[Si](C)(C)C(C)C)C1 |
| InChI | InChI=1S/C28H46O5Si/c1-18(2)34(6,7)33-24-9-8-22-25-23(11-13-27(22,24)5)26(4)12-10-21(32-19(3)29)16-20(26)17-28(25)30-14-15-31-28/h17-18,21-25H,8-16H2,1-7H3/t21-,22?,23?,24-,25?,26-,27-/m0/s1 |
| InChIKey | AQZPDPAYSKTHIW-QLMFNQMASA-N |
| XLogP | 6.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.76 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|