C29H48O5Si — CID 173269194
[(8S,9S,10R,13S,14S,17R)-17-tert-butyl-1-dimethylsilyloxy-10,13-dimethylspiro[1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-7,2'-1,3-dioxolane]-3-yl] acetate (PubChem CID 173269194) has the molecular formula C29H48O5Si and a molecular weight of 504.78 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17R)-17-tert-butyl-1-dimethylsilyloxy-10,13-dimethylspiro[1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-7,2'-1,3-dioxolane]-3-yl] acetate.
| Compound Name | [(8S,9S,10R,13S,14S,17R)-17-tert-butyl-1-dimethylsilyloxy-10,13-dimethylspiro[1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-7,2'-1,3-dioxolane]-3-yl] acetate |
|---|---|
| PubChem CID | 173269194 |
| Molecular Formula | C29H48O5Si |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 504.33 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17R)-17-tert-butyl-1-dimethylsilyloxy-10,13-dimethylspiro[1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-7,2'-1,3-dioxolane]-3-yl] acetate |
| SMILES | CC(=O)OC1CC2=CC3(OCCO3)[C@H]3[C@@H]4CC[C@H](C(C)(C)C)[C@@]4(C)CC[C@@H]3[C@@]2(C)C(O[SiH](C)C)C1 |
| InChI | InChI=1S/C29H48O5Si/c1-18(30)33-20-15-19-17-29(31-13-14-32-29)25-21-9-10-23(26(2,3)4)27(21,5)12-11-22(25)28(19,6)24(16-20)34-35(7)8/h17,20-25,35H,9-16H2,1-8H3/t20?,21-,22-,23+,24?,25-,27-,28-/m0/s1 |
| InChIKey | ZVRFWSWIUZVOHW-HPELWOQTSA-N |
| XLogP | 5.87 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|