C22H32O4 — CID 567544
3-methoxy-13-methylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-10-carbaldehyde (PubChem CID 567544) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is 3-methoxy-13-methylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-10-carbaldehyde.
| Compound Name | 3-methoxy-13-methylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-10-carbaldehyde |
|---|---|
| PubChem CID | 567544 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 3-methoxy-13-methylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-10-carbaldehyde |
| SMILES | COC1CCC2(C=O)C(=CCC3C2CCC2(C)C3CCC23OCCO3)C1 |
| InChI | InChI=1S/C22H32O4/c1-20-8-6-19-17(18(20)7-10-22(20)25-11-12-26-22)4-3-15-13-16(24-2)5-9-21(15,19)14-23/h3,14,16-19H,4-13H2,1-2H3 |
| InChIKey | SWSCEGVKBIEYBI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|