C27H38O6 — CID 54514194
CID 54514194 (PubChem CID 54514194) has the molecular formula C27H38O6 and a molecular weight of 458.60 g/mol.
| Compound Name | CID 54514194 |
|---|---|
| PubChem CID | 54514194 |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C=C[C@]12CCC3(CC1=CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CCC21OCCO1)OCCO3 |
| InChI | InChI=1S/C27H38O6/c1-3-29-23(28)8-10-25-12-13-26(30-14-15-31-26)18-19(25)4-5-20-21-7-11-27(32-16-17-33-27)24(21,2)9-6-22(20)25/h4,8,10,20-22H,3,5-7,9,11-18H2,1-2H3/t20-,21-,22-,24-,25-/m0/s1 |
| InChIKey | YLGHSLWFTUSCIK-YNFQPMOCSA-N |
| XLogP | 4.53 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|