C25H36O6 — CID 22847993
CID 22847993 (PubChem CID 22847993) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol.
| Compound Name | CID 22847993 |
|---|---|
| PubChem CID | 22847993 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | — |
| SMILES | CC(=O)OC[C@]12CCC3(CC1=CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CCC21OCCO1)OCCO3 |
| InChI | InChI=1S/C25H36O6/c1-17(26)27-16-23-9-10-24(28-11-12-29-24)15-18(23)3-4-19-20-6-8-25(30-13-14-31-25)22(20,2)7-5-21(19)23/h3,19-21H,4-16H2,1-2H3/t19-,20-,21-,22-,23+/m0/s1 |
| InChIKey | RSIJLRABDAOOHC-XZCBWCRCSA-N |
| XLogP | 3.98 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|