C27H38O6S — CID 58635939
[2-[(13S)-10-(acetylsulfanylmethyl)-13-methylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl]-2-oxoethyl] acetate (PubChem CID 58635939) has the molecular formula C27H38O6S and a molecular weight of 490.66 g/mol. Its IUPAC name is [2-[(13S)-10-(acetylsulfanylmethyl)-13-methylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(13S)-10-(acetylsulfanylmethyl)-13-methylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 58635939 |
| Molecular Formula | C27H38O6S |
| Molecular Weight | 490.66 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | [2-[(13S)-10-(acetylsulfanylmethyl)-13-methylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)C1CCC2C3CC=C4CC5(CCC4(CSC(C)=O)C3CC[C@]12C)OCCO5 |
| InChI | InChI=1S/C27H38O6S/c1-17(28)31-15-24(30)23-7-6-21-20-5-4-19-14-27(32-12-13-33-27)11-10-26(19,16-34-18(2)29)22(20)8-9-25(21,23)3/h4,20-23H,5-16H2,1-3H3/t20?,21?,22?,23?,25-,26?/m0/s1 |
| InChIKey | VZKKIXAEWAYGDP-PVKBTOEVSA-N |
| XLogP | 4.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|